C22H32N6O2 — CID 166234540
1-N,4-N-bis(5-propyl-1H-pyrazol-3-yl)bicyclo[2.2.2]octane-1,4-dicarboxamide (PubChem CID 166234540) has the molecular formula C22H32N6O2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 1-N,4-N-bis(5-propyl-1H-pyrazol-3-yl)bicyclo[2.2.2]octane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(5-propyl-1H-pyrazol-3-yl)bicyclo[2.2.2]octane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 166234540 |
| Molecular Formula | C22H32N6O2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 1-N,4-N-bis(5-propyl-1H-pyrazol-3-yl)bicyclo[2.2.2]octane-1,4-dicarboxamide |
| SMILES | CCCc1cc(NC(=O)C23CCC(C(=O)Nc4cc(CCC)[nH]n4)(CC2)CC3)n[nH]1 |
| InChI | InChI=1S/C22H32N6O2/c1-3-5-15-13-17(27-25-15)23-19(29)21-7-10-22(11-8-21,12-9-21)20(30)24-18-14-16(6-4-2)26-28-18/h13-14H,3-12H2,1-2H3,(H2,23,25,27,29)(H2,24,26,28,30) |
| InChIKey | PLNLOWLCVGNHAF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |