C15H11Cl3N2O4 — CID 2977495
3,5-dichloro-N-(2-chloro-4-nitrophenyl)-4-ethoxybenzamide (PubChem CID 2977495) has the molecular formula C15H11Cl3N2O4 and a molecular weight of 389.62 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-chloro-4-nitrophenyl)-4-ethoxybenzamide.
| Compound Name | 3,5-dichloro-N-(2-chloro-4-nitrophenyl)-4-ethoxybenzamide |
|---|---|
| PubChem CID | 2977495 |
| Molecular Formula | C15H11Cl3N2O4 |
| Molecular Weight | 389.62 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 3,5-dichloro-N-(2-chloro-4-nitrophenyl)-4-ethoxybenzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl3N2O4/c1-2-24-14-11(17)5-8(6-12(14)18)15(21)19-13-4-3-9(20(22)23)7-10(13)16/h3-7H,2H2,1H3,(H,19,21) |
| InChIKey | QNAOEGOCNACRJL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|