C25H33NO3Si — CID 177460480
[(1E,3E)-4-(4-nitrophenyl)-1-phenylbuta-1,3-dienoxy]-tri(propan-2-yl)silane (PubChem CID 177460480) has the molecular formula C25H33NO3Si and a molecular weight of 423.63 g/mol. Its IUPAC name is [(1E,3E)-4-(4-nitrophenyl)-1-phenylbuta-1,3-dienoxy]-tri(propan-2-yl)silane.
| Compound Name | [(1E,3E)-4-(4-nitrophenyl)-1-phenylbuta-1,3-dienoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 177460480 |
| Molecular Formula | C25H33NO3Si |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | [(1E,3E)-4-(4-nitrophenyl)-1-phenylbuta-1,3-dienoxy]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](O/C(=C/C=C/c1ccc([N+](=O)[O-])cc1)c1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H33NO3Si/c1-19(2)30(20(3)4,21(5)6)29-25(23-12-8-7-9-13-23)14-10-11-22-15-17-24(18-16-22)26(27)28/h7-21H,1-6H3/b11-10+,25-14+ |
| InChIKey | XZPSDXURRQXLOU-WFBSJYIVSA-N |
| XLogP | 7.84 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|