C19H29NO3Si — CID 154710233
[(3E)-4-(4-nitrophenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane (PubChem CID 154710233) has the molecular formula C19H29NO3Si and a molecular weight of 347.53 g/mol. Its IUPAC name is [(3E)-4-(4-nitrophenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(3E)-4-(4-nitrophenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 154710233 |
| Molecular Formula | C19H29NO3Si |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | [(3E)-4-(4-nitrophenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C=C(/C=C/c1ccc([N+](=O)[O-])cc1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H29NO3Si/c1-14(2)24(15(3)4,16(5)6)23-17(7)8-9-18-10-12-19(13-11-18)20(21)22/h8-16H,7H2,1-6H3/b9-8+ |
| InChIKey | PFJIHUYFISUKRJ-CMDGGOBGSA-N |
| XLogP | 6.31 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|