C24H22N4O6 — CID 6039924
3-acetamido-N-[(Z)-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylideneamino]benzamide (PubChem CID 6039924) has the molecular formula C24H22N4O6 and a molecular weight of 462.46 g/mol. Its IUPAC name is 3-acetamido-N-[(Z)-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 3-acetamido-N-[(Z)-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 6039924 |
| Molecular Formula | C24H22N4O6 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 3-acetamido-N-[(Z)-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cccc(NC(C)=O)c2)c([N+](=O)[O-])cc1OCc1ccccc1 |
| InChI | InChI=1S/C24H22N4O6/c1-16(29)26-20-10-6-9-18(11-20)24(30)27-25-14-19-12-22(33-2)23(13-21(19)28(31)32)34-15-17-7-4-3-5-8-17/h3-14H,15H2,1-2H3,(H,26,29)(H,27,30)/b25-14- |
| InChIKey | YETCUVOLJQDHKY-QFEZKATASA-N |
| XLogP | 3.90 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|