C20H17Cl2N3O3 — CID 136808208
(2S)-2-(2,4-dichlorophenoxy)-N-[(Z)-(2-oxo-1H-quinolin-3-yl)methylideneamino]butanamide (PubChem CID 136808208) has the molecular formula C20H17Cl2N3O3 and a molecular weight of 418.28 g/mol. Its IUPAC name is (2S)-2-(2,4-dichlorophenoxy)-N-[(Z)-(2-oxo-1H-quinolin-3-yl)methylideneamino]butanamide.
| Compound Name | (2S)-2-(2,4-dichlorophenoxy)-N-[(Z)-(2-oxo-1H-quinolin-3-yl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 136808208 |
| Molecular Formula | C20H17Cl2N3O3 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | (2S)-2-(2,4-dichlorophenoxy)-N-[(Z)-(2-oxo-1H-quinolin-3-yl)methylideneamino]butanamide |
| SMILES | CC[C@H](Oc1ccc(Cl)cc1Cl)C(=O)N/N=C\c1cc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C20H17Cl2N3O3/c1-2-17(28-18-8-7-14(21)10-15(18)22)20(27)25-23-11-13-9-12-5-3-4-6-16(12)24-19(13)26/h3-11,17H,2H2,1H3,(H,24,26)(H,25,27)/b23-11-/t17-/m0/s1 |
| InChIKey | BIWATLXIPCQLLH-CMBCABCVSA-N |
| XLogP | 4.14 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|