C18H15ClN4O4S — CID 4058223
2-[(4-chlorophenyl)sulfonylamino]-N-[(2-oxo-1H-quinolin-3-yl)methylideneamino]acetamide (PubChem CID 4058223) has the molecular formula C18H15ClN4O4S and a molecular weight of 418.86 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]-N-[(2-oxo-1H-quinolin-3-yl)methylideneamino]acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]-N-[(2-oxo-1H-quinolin-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4058223 |
| Molecular Formula | C18H15ClN4O4S |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]-N-[(2-oxo-1H-quinolin-3-yl)methylideneamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(Cl)cc1)NN=Cc1cc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C18H15ClN4O4S/c19-14-5-7-15(8-6-14)28(26,27)21-11-17(24)23-20-10-13-9-12-3-1-2-4-16(12)22-18(13)25/h1-10,21H,11H2,(H,22,25)(H,23,24) |
| InChIKey | WFELRFOKPIZYBY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 120.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|