C17H12IN3O2 — CID 135615366
2-iodo-N-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]benzamide (PubChem CID 135615366) has the molecular formula C17H12IN3O2 and a molecular weight of 417.21 g/mol. Its IUPAC name is 2-iodo-N-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]benzamide.
| Compound Name | 2-iodo-N-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135615366 |
| Molecular Formula | C17H12IN3O2 |
| Molecular Weight | 417.21 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | 2-iodo-N-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1cc2ccccc2[nH]c1=O)c1ccccc1I |
| InChI | InChI=1S/C17H12IN3O2/c18-14-7-3-2-6-13(14)17(23)21-19-10-12-9-11-5-1-4-8-15(11)20-16(12)22/h1-10H,(H,20,22)(H,21,23)/b19-10+ |
| InChIKey | MHECQVIAXMPDQW-VXLYETTFSA-N |
| XLogP | 2.90 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|