C18H13Cl2NO2S — CID 16561708
(2,4-dichlorophenyl) 2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]acetate (PubChem CID 16561708) has the molecular formula C18H13Cl2NO2S and a molecular weight of 378.28 g/mol. Its IUPAC name is (2,4-dichlorophenyl) 2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | (2,4-dichlorophenyl) 2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 16561708 |
| Molecular Formula | C18H13Cl2NO2S |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | (2,4-dichlorophenyl) 2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]acetate |
| SMILES | Cc1cccc(-c2nc(CC(=O)Oc3ccc(Cl)cc3Cl)cs2)c1 |
| InChI | InChI=1S/C18H13Cl2NO2S/c1-11-3-2-4-12(7-11)18-21-14(10-24-18)9-17(22)23-16-6-5-13(19)8-15(16)20/h2-8,10H,9H2,1H3 |
| InChIKey | LQIYKLUVXAQODV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|