C16H20N2OS — CID 78809222
N,N-diethyl-2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 78809222) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is N,N-diethyl-2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N,N-diethyl-2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 78809222 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N,N-diethyl-2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | CCN(CC)C(=O)Cc1csc(-c2cccc(C)c2)n1 |
| InChI | InChI=1S/C16H20N2OS/c1-4-18(5-2)15(19)10-14-11-20-16(17-14)13-8-6-7-12(3)9-13/h6-9,11H,4-5,10H2,1-3H3 |
| InChIKey | QPSHCKBHXBVVER-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |