methyl 2-[2-(2-chloro-6-methoxyphenyl)-1,3-thiazol-4-yl]acetate

C13H12ClNO3S — CID 113456409

IUPACmethyl 2-[2-(2-chloro-6-methoxyphenyl)-1,3-thiazol-4-yl]acetate
SMILESCOC(=O)Cc1csc(-c2c(Cl)cccc2OC)n1
InChIInChI=1S/C13H12ClNO3S/c1-17-10-5-3-4-9(14)12(10)13-15-8(7-19-13)6-11(16)18-2/h3-5,7H,6H2,1-2H3
InChIKeyZUSPQBZOEZWGKZ-UHFFFAOYSA-N
MW297.76 g/mol
LogP3.19
Rot. Bonds4

About methyl 2-[2-(2-chloro-6-methoxyphenyl)-1,3-thiazol-4-yl]acetate

methyl 2-[2-(2-chloro-6-methoxyphenyl)-1,3-thiazol-4-yl]acetate (PubChem CID 113456409) has the molecular formula C13H12ClNO3S and a molecular weight of 297.76 g/mol. Its IUPAC name is methyl 2-[2-(2-chloro-6-methoxyphenyl)-1,3-thiazol-4-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[2-(2-chloro-6-methoxyphenyl)-1,3-thiazol-4-yl]acetate
PubChem CID113456409
Molecular FormulaC13H12ClNO3S
Molecular Weight297.76 g/mol
Exact Mass297.02
IUPAC Namemethyl 2-[2-(2-chloro-6-methoxyphenyl)-1,3-thiazol-4-yl]acetate
SMILESCOC(=O)Cc1csc(-c2c(Cl)cccc2OC)n1
InChIInChI=1S/C13H12ClNO3S/c1-17-10-5-3-4-9(14)12(10)13-15-8(7-19-13)6-11(16)18-2/h3-5,7H,6H2,1-2H3
InChIKeyZUSPQBZOEZWGKZ-UHFFFAOYSA-N
XLogP3.19
TPSA48.42 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.76
LogP ≤ 53.19
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[2-(2-chloro-6-methoxyphenyl)-1,3-thiazol-4-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[2-(2-chloro-6-methoxyphenyl)-1,3-thiazol-4-yl]acetate?
The IUPAC name of methyl 2-[2-(2-chloro-6-methoxyphenyl)-1,3-thiazol-4-yl]acetate (CID 113456409) is methyl 2-[2-(2-chloro-6-methoxyphenyl)-1,3-thiazol-4-yl]acetate.
What is the SMILES notation for methyl 2-[2-(2-chloro-6-methoxyphenyl)-1,3-thiazol-4-yl]acetate?
The canonical SMILES for methyl 2-[2-(2-chloro-6-methoxyphenyl)-1,3-thiazol-4-yl]acetate is COC(=O)Cc1csc(-c2c(Cl)cccc2OC)n1.
What is the InChIKey of methyl 2-[2-(2-chloro-6-methoxyphenyl)-1,3-thiazol-4-yl]acetate?
The InChIKey is ZUSPQBZOEZWGKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClNO3S/c1-17-10-5-3-4-9(14)12(10)13-15-8(7-19-13)6-11(16)18-2/h3-5,7H,6H2,1-2H3.
What are the key properties of methyl 2-[2-(2-chloro-6-methoxyphenyl)-1,3-thiazol-4-yl]acetate?
methyl 2-[2-(2-chloro-6-methoxyphenyl)-1,3-thiazol-4-yl]acetate has a molecular weight of 297.76 g/mol, XLogP of 3.19, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(2-chloro-6-methoxyphenyl)-1,3-thiazol-4-yl]acetate is sourced from PubChem (CID 113456409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).