C22H37NO4 — CID 154435594
3-nitro-4,5-dioctylbenzene-1,2-diol (PubChem CID 154435594) has the molecular formula C22H37NO4 and a molecular weight of 379.54 g/mol. Its IUPAC name is 3-nitro-4,5-dioctylbenzene-1,2-diol.
| Compound Name | 3-nitro-4,5-dioctylbenzene-1,2-diol |
|---|---|
| PubChem CID | 154435594 |
| Molecular Formula | C22H37NO4 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | 3-nitro-4,5-dioctylbenzene-1,2-diol |
| SMILES | CCCCCCCCc1cc(O)c(O)c([N+](=O)[O-])c1CCCCCCCC |
| InChI | InChI=1S/C22H37NO4/c1-3-5-7-9-11-13-15-18-17-20(24)22(25)21(23(26)27)19(18)16-14-12-10-8-6-4-2/h17,24-25H,3-16H2,1-2H3 |
| InChIKey | UYSXMNPLTLEJKU-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|