C11H16N2O3S — CID 122670193
3-butyl-2-sulfamoylbenzamide (PubChem CID 122670193) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 3-butyl-2-sulfamoylbenzamide.
| Compound Name | 3-butyl-2-sulfamoylbenzamide |
|---|---|
| PubChem CID | 122670193 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3-butyl-2-sulfamoylbenzamide |
| SMILES | CCCCc1cccc(C(N)=O)c1S(N)(=O)=O |
| InChI | InChI=1S/C11H16N2O3S/c1-2-3-5-8-6-4-7-9(11(12)14)10(8)17(13,15)16/h4,6-7H,2-3,5H2,1H3,(H2,12,14)(H2,13,15,16) |
| InChIKey | SYCXSOCPCZOCTF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |