C20H31NO4 — CID 91715808
[2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] acetate (PubChem CID 91715808) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is [2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] acetate.
| Compound Name | [2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 91715808 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | [2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] acetate |
| SMILES | COc1cc(CNC(=O)CCCCCCC(C)C)ccc1OC(C)=O |
| InChI | InChI=1S/C20H31NO4/c1-15(2)9-7-5-6-8-10-20(23)21-14-17-11-12-18(25-16(3)22)19(13-17)24-4/h11-13,15H,5-10,14H2,1-4H3,(H,21,23) |
| InChIKey | FABOGEJIOHNBJZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|