C20H28F3NO4 — CID 91737115
[2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 91737115) has the molecular formula C20H28F3NO4 and a molecular weight of 403.44 g/mol. Its IUPAC name is [2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91737115 |
| Molecular Formula | C20H28F3NO4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | [2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | COc1cc(CNC(=O)CCCCCCC(C)C)ccc1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H28F3NO4/c1-14(2)8-6-4-5-7-9-18(25)24-13-15-10-11-16(17(12-15)27-3)28-19(26)20(21,22)23/h10-12,14H,4-9,13H2,1-3H3,(H,24,25) |
| InChIKey | RXVYELDAQCJVFS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|