C19H31NO6S — CID 145358690
[2-methoxy-4-[(8-methylnonanoylamino)methyl]phenoxy]methyl hydrogen sulfite (PubChem CID 145358690) has the molecular formula C19H31NO6S and a molecular weight of 401.53 g/mol. Its IUPAC name is [2-methoxy-4-[(8-methylnonanoylamino)methyl]phenoxy]methyl hydrogen sulfite.
| Compound Name | [2-methoxy-4-[(8-methylnonanoylamino)methyl]phenoxy]methyl hydrogen sulfite |
|---|---|
| PubChem CID | 145358690 |
| Molecular Formula | C19H31NO6S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | [2-methoxy-4-[(8-methylnonanoylamino)methyl]phenoxy]methyl hydrogen sulfite |
| SMILES | COc1cc(CNC(=O)CCCCCCC(C)C)ccc1OCOS(=O)O |
| InChI | InChI=1S/C19H31NO6S/c1-15(2)8-6-4-5-7-9-19(21)20-13-16-10-11-17(18(12-16)24-3)25-14-26-27(22)23/h10-12,15H,4-9,13-14H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | PJOKUTVABOHNBF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|