C34H41NO5 — CID 141228837
[2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] 2-(3-benzoylphenyl)propanoate (PubChem CID 141228837) has the molecular formula C34H41NO5 and a molecular weight of 543.70 g/mol. Its IUPAC name is [2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] 2-(3-benzoylphenyl)propanoate.
| Compound Name | [2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] 2-(3-benzoylphenyl)propanoate |
|---|---|
| PubChem CID | 141228837 |
| Molecular Formula | C34H41NO5 |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | [2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] 2-(3-benzoylphenyl)propanoate |
| SMILES | COc1cc(CNC(=O)CCCCCCC(C)C)ccc1OC(=O)C(C)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C34H41NO5/c1-24(2)13-8-5-6-11-18-32(36)35-23-26-19-20-30(31(21-26)39-4)40-34(38)25(3)28-16-12-17-29(22-28)33(37)27-14-9-7-10-15-27/h7,9-10,12,14-17,19-22,24-25H,5-6,8,11,13,18,23H2,1-4H3,(H,35,36) |
| InChIKey | YSLDXJYCYDLRNC-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|