C36H49N3O11S — CID 46940102
1-O-[6-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]hexyl] 4-O-[2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] butanedioate (PubChem CID 46940102) has the molecular formula C36H49N3O11S and a molecular weight of 731.87 g/mol. Its IUPAC name is 1-O-[6-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]hexyl] 4-O-[2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] butanedioate.
| Compound Name | 1-O-[6-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]hexyl] 4-O-[2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] butanedioate |
|---|---|
| PubChem CID | 46940102 |
| Molecular Formula | C36H49N3O11S |
| Molecular Weight | 731.87 g/mol |
| Exact Mass | 731.31 |
| IUPAC Name | 1-O-[6-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]hexyl] 4-O-[2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] butanedioate |
| SMILES | COc1cc(CNC(=O)CCCCCCC(C)C)ccc1OC(=O)CCC(=O)OCCCCCCOc1no[n+]([O-])c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H49N3O11S/c1-27(2)15-9-4-5-12-18-32(40)37-26-28-19-20-30(31(25-28)46-3)49-34(42)22-21-33(41)47-23-13-6-7-14-24-48-35-36(39(43)50-38-35)51(44,45)29-16-10-8-11-17-29/h8,10-11,16-17,19-20,25,27H,4-7,9,12-15,18,21-24,26H2,1-3H3,(H,37,40) |
| InChIKey | DVAYNRGWLHCAFU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 187.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.87 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|