C32H40N4O10S — CID 46940993
[2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] 4-[2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]ethylamino]-4-oxobutanoate (PubChem CID 46940993) has the molecular formula C32H40N4O10S and a molecular weight of 672.76 g/mol. Its IUPAC name is [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] 4-[2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]ethylamino]-4-oxobutanoate.
| Compound Name | [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] 4-[2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 46940993 |
| Molecular Formula | C32H40N4O10S |
| Molecular Weight | 672.76 g/mol |
| Exact Mass | 672.25 |
| IUPAC Name | [2-methoxy-4-[[[(E)-8-methylnon-6-enoyl]amino]methyl]phenyl] 4-[2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]ethylamino]-4-oxobutanoate |
| SMILES | COc1cc(CNC(=O)CCCC/C=C/C(C)C)ccc1OC(=O)CCC(=O)NCCOc1no[n+]([O-])c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H40N4O10S/c1-23(2)11-7-4-5-10-14-28(37)34-22-24-15-16-26(27(21-24)43-3)45-30(39)18-17-29(38)33-19-20-44-31-32(36(40)46-35-31)47(41,42)25-12-8-6-9-13-25/h6-9,11-13,15-16,21,23H,4-5,10,14,17-20,22H2,1-3H3,(H,33,38)(H,34,37)/b11-7+ |
| InChIKey | IKVZMEDNLADZEY-YRNVUSSQSA-N |
| XLogP | 3.42 |
| TPSA | 190.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.76 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|