C25H44N2O4 — CID 10048678
N-[[4-[2-hydroxy-3-(2-methylbutylamino)propoxy]-3-methoxyphenyl]methyl]nonanamide (PubChem CID 10048678) has the molecular formula C25H44N2O4 and a molecular weight of 436.64 g/mol. Its IUPAC name is N-[[4-[2-hydroxy-3-(2-methylbutylamino)propoxy]-3-methoxyphenyl]methyl]nonanamide.
| Compound Name | N-[[4-[2-hydroxy-3-(2-methylbutylamino)propoxy]-3-methoxyphenyl]methyl]nonanamide |
|---|---|
| PubChem CID | 10048678 |
| Molecular Formula | C25H44N2O4 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | N-[[4-[2-hydroxy-3-(2-methylbutylamino)propoxy]-3-methoxyphenyl]methyl]nonanamide |
| SMILES | CCCCCCCCC(=O)NCc1ccc(OCC(O)CNCC(C)CC)c(OC)c1 |
| InChI | InChI=1S/C25H44N2O4/c1-5-7-8-9-10-11-12-25(29)27-17-21-13-14-23(24(15-21)30-4)31-19-22(28)18-26-16-20(3)6-2/h13-15,20,22,26,28H,5-12,16-19H2,1-4H3,(H,27,29) |
| InChIKey | QSGYVOGLSHQMTR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|