C31H49N3O4 — CID 68814449
2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;N-[(4-hydroxy-3-methoxyphenyl)methyl]nonanamide (PubChem CID 68814449) has the molecular formula C31H49N3O4 and a molecular weight of 527.75 g/mol. Its IUPAC name is 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;N-[(4-hydroxy-3-methoxyphenyl)methyl]nonanamide.
| Compound Name | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;N-[(4-hydroxy-3-methoxyphenyl)methyl]nonanamide |
|---|---|
| PubChem CID | 68814449 |
| Molecular Formula | C31H49N3O4 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.37 |
| IUPAC Name | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;N-[(4-hydroxy-3-methoxyphenyl)methyl]nonanamide |
| SMILES | CCCCCCCCC(=O)NCc1ccc(O)c(OC)c1.CCN(CC)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C17H27NO3.C14H22N2O/c1-3-4-5-6-7-8-9-17(20)18-13-14-10-11-15(19)16(12-14)21-2;1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h10-12,19H,3-9,13H2,1-2H3,(H,18,20);7-9H,5-6,10H2,1-4H3,(H,15,17) |
| InChIKey | UKPGPSWHVQFLRG-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|