C34H53N3O4 — CID 24768772
N-[[3-[5-(2,6-dimethylanilino)-4-[ethyl(propyl)amino]-5-oxopentoxy]-4-hydroxyphenyl]methyl]nonanamide (PubChem CID 24768772) has the molecular formula C34H53N3O4 and a molecular weight of 567.82 g/mol. Its IUPAC name is N-[[3-[5-(2,6-dimethylanilino)-4-[ethyl(propyl)amino]-5-oxopentoxy]-4-hydroxyphenyl]methyl]nonanamide.
| Compound Name | N-[[3-[5-(2,6-dimethylanilino)-4-[ethyl(propyl)amino]-5-oxopentoxy]-4-hydroxyphenyl]methyl]nonanamide |
|---|---|
| PubChem CID | 24768772 |
| Molecular Formula | C34H53N3O4 |
| Molecular Weight | 567.82 g/mol |
| Exact Mass | 567.40 |
| IUPAC Name | N-[[3-[5-(2,6-dimethylanilino)-4-[ethyl(propyl)amino]-5-oxopentoxy]-4-hydroxyphenyl]methyl]nonanamide |
| SMILES | CCCCCCCCC(=O)NCc1ccc(O)c(OCCCC(C(=O)Nc2c(C)cccc2C)N(CC)CCC)c1 |
| InChI | InChI=1S/C34H53N3O4/c1-6-9-10-11-12-13-19-32(39)35-25-28-20-21-30(38)31(24-28)41-23-15-18-29(37(8-3)22-7-2)34(40)36-33-26(4)16-14-17-27(33)5/h14,16-17,20-21,24,29,38H,6-13,15,18-19,22-23,25H2,1-5H3,(H,35,39)(H,36,40) |
| InChIKey | SAGZEGKXJBYFCY-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.82 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|