C18H32N2O4S — CID 75989741
N-(2,6-dimethylphenyl)-2-[ethyl(propyl)amino]butanamide;methanesulfonic acid (PubChem CID 75989741) has the molecular formula C18H32N2O4S and a molecular weight of 372.53 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[ethyl(propyl)amino]butanamide;methanesulfonic acid.
| Compound Name | N-(2,6-dimethylphenyl)-2-[ethyl(propyl)amino]butanamide;methanesulfonic acid |
|---|---|
| PubChem CID | 75989741 |
| Molecular Formula | C18H32N2O4S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[ethyl(propyl)amino]butanamide;methanesulfonic acid |
| SMILES | CCCN(CC)C(CC)C(=O)Nc1c(C)cccc1C.CS(=O)(=O)O |
| InChI | InChI=1S/C17H28N2O.CH4O3S/c1-6-12-19(8-3)15(7-2)17(20)18-16-13(4)10-9-11-14(16)5;1-5(2,3)4/h9-11,15H,6-8,12H2,1-5H3,(H,18,20);1H3,(H,2,3,4) |
| InChIKey | YEANWQGJNWTKTE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|