C22H42N2O — CID 145255020
2-[butyl(ethyl)amino]-N-(2,6-dimethylphenyl)butanamide;ethane (PubChem CID 145255020) has the molecular formula C22H42N2O and a molecular weight of 350.59 g/mol. Its IUPAC name is 2-[butyl(ethyl)amino]-N-(2,6-dimethylphenyl)butanamide;ethane.
| Compound Name | 2-[butyl(ethyl)amino]-N-(2,6-dimethylphenyl)butanamide;ethane |
|---|---|
| PubChem CID | 145255020 |
| Molecular Formula | C22H42N2O |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.33 |
| IUPAC Name | 2-[butyl(ethyl)amino]-N-(2,6-dimethylphenyl)butanamide;ethane |
| SMILES | CC.CC.CCCCN(CC)C(CC)C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C18H30N2O.2C2H6/c1-6-9-13-20(8-3)16(7-2)18(21)19-17-14(4)11-10-12-15(17)5;2*1-2/h10-12,16H,6-9,13H2,1-5H3,(H,19,21);2*1-2H3 |
| InChIKey | ZPNOWBYUQORJKI-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |