C21H35N3O3 — CID 24847042
ethyl 2-[2,3-bis(diethylamino)propanoylamino]-3-methylbenzoate (PubChem CID 24847042) has the molecular formula C21H35N3O3 and a molecular weight of 377.53 g/mol. Its IUPAC name is ethyl 2-[2,3-bis(diethylamino)propanoylamino]-3-methylbenzoate.
| Compound Name | ethyl 2-[2,3-bis(diethylamino)propanoylamino]-3-methylbenzoate |
|---|---|
| PubChem CID | 24847042 |
| Molecular Formula | C21H35N3O3 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | ethyl 2-[2,3-bis(diethylamino)propanoylamino]-3-methylbenzoate |
| SMILES | CCOC(=O)c1cccc(C)c1NC(=O)C(CN(CC)CC)N(CC)CC |
| InChI | InChI=1S/C21H35N3O3/c1-7-23(8-2)15-18(24(9-3)10-4)20(25)22-19-16(6)13-12-14-17(19)21(26)27-11-5/h12-14,18H,7-11,15H2,1-6H3,(H,22,25) |
| InChIKey | QNSVTVUYARJUTB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |