C18H29N5OS — CID 3004270
3-(carbamothioylhydrazinylidene)-2-(diethylaminomethyl)-N-(2,6-dimethylphenyl)butanamide (PubChem CID 3004270) has the molecular formula C18H29N5OS and a molecular weight of 363.53 g/mol. Its IUPAC name is 3-(carbamothioylhydrazinylidene)-2-(diethylaminomethyl)-N-(2,6-dimethylphenyl)butanamide.
| Compound Name | 3-(carbamothioylhydrazinylidene)-2-(diethylaminomethyl)-N-(2,6-dimethylphenyl)butanamide |
|---|---|
| PubChem CID | 3004270 |
| Molecular Formula | C18H29N5OS |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 3-(carbamothioylhydrazinylidene)-2-(diethylaminomethyl)-N-(2,6-dimethylphenyl)butanamide |
| SMILES | CCN(CC)CC(C(=O)Nc1c(C)cccc1C)C(C)=NNC(N)=S |
| InChI | InChI=1S/C18H29N5OS/c1-6-23(7-2)11-15(14(5)21-22-18(19)25)17(24)20-16-12(3)9-8-10-13(16)4/h8-10,15H,6-7,11H2,1-5H3,(H,20,24)(H3,19,22,25) |
| InChIKey | XHWUYFYYKFGRCQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|