C26H42ClN3O4 — CID 24848052
N-(2,6-dimethylphenyl)-2-[ethyl(propyl)amino]butanamide;4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;hydrochloride (PubChem CID 24848052) has the molecular formula C26H42ClN3O4 and a molecular weight of 496.09 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[ethyl(propyl)amino]butanamide;4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;hydrochloride.
| Compound Name | N-(2,6-dimethylphenyl)-2-[ethyl(propyl)amino]butanamide;4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 24848052 |
| Molecular Formula | C26H42ClN3O4 |
| Molecular Weight | 496.09 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[ethyl(propyl)amino]butanamide;4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;hydrochloride |
| SMILES | CCCN(CC)C(CC)C(=O)Nc1c(C)cccc1C.CNC[C@H](O)c1ccc(O)c(O)c1.Cl |
| InChI | InChI=1S/C17H28N2O.C9H13NO3.ClH/c1-6-12-19(8-3)15(7-2)17(20)18-16-13(4)10-9-11-14(16)5;1-10-5-9(13)6-2-3-7(11)8(12)4-6;/h9-11,15H,6-8,12H2,1-5H3,(H,18,20);2-4,9-13H,5H2,1H3;1H/t;9-;/m.0./s1 |
| InChIKey | DBIOIWAVQRFRFA-QKWFRNNBSA-N |
| XLogP | 4.52 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.09 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|