C19H32N2O6S — CID 150761252
2-[butan-2-yloxymethoxy(butyl)sulfamoyl]-N-(2,6-dimethylphenyl)-2-hydroxyacetamide (PubChem CID 150761252) has the molecular formula C19H32N2O6S and a molecular weight of 416.54 g/mol. Its IUPAC name is 2-[butan-2-yloxymethoxy(butyl)sulfamoyl]-N-(2,6-dimethylphenyl)-2-hydroxyacetamide.
| Compound Name | 2-[butan-2-yloxymethoxy(butyl)sulfamoyl]-N-(2,6-dimethylphenyl)-2-hydroxyacetamide |
|---|---|
| PubChem CID | 150761252 |
| Molecular Formula | C19H32N2O6S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 2-[butan-2-yloxymethoxy(butyl)sulfamoyl]-N-(2,6-dimethylphenyl)-2-hydroxyacetamide |
| SMILES | CCCCN(OCOC(C)CC)S(=O)(=O)C(O)C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C19H32N2O6S/c1-6-8-12-21(27-13-26-16(5)7-2)28(24,25)19(23)18(22)20-17-14(3)10-9-11-15(17)4/h9-11,16,19,23H,6-8,12-13H2,1-5H3,(H,20,22) |
| InChIKey | JXWMNIDJHRKMCH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|