C15H24N2O6S — CID 151706600
2-[ethoxymethoxy(methyl)sulfamoyl]-N-(2-ethyl-6-methylphenyl)-2-hydroxyacetamide (PubChem CID 151706600) has the molecular formula C15H24N2O6S and a molecular weight of 360.43 g/mol. Its IUPAC name is 2-[ethoxymethoxy(methyl)sulfamoyl]-N-(2-ethyl-6-methylphenyl)-2-hydroxyacetamide.
| Compound Name | 2-[ethoxymethoxy(methyl)sulfamoyl]-N-(2-ethyl-6-methylphenyl)-2-hydroxyacetamide |
|---|---|
| PubChem CID | 151706600 |
| Molecular Formula | C15H24N2O6S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-[ethoxymethoxy(methyl)sulfamoyl]-N-(2-ethyl-6-methylphenyl)-2-hydroxyacetamide |
| SMILES | CCOCON(C)S(=O)(=O)C(O)C(=O)Nc1c(C)cccc1CC |
| InChI | InChI=1S/C15H24N2O6S/c1-5-12-9-7-8-11(3)13(12)16-14(18)15(19)24(20,21)17(4)23-10-22-6-2/h7-9,15,19H,5-6,10H2,1-4H3,(H,16,18) |
| InChIKey | RFSFHNVTSGCYMU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|