C17H24N2O6S — CID 150437938
N-(2,6-dimethylphenyl)-2-hydroxy-2-[propan-2-yl(prop-2-ynoxymethoxy)sulfamoyl]acetamide (PubChem CID 150437938) has the molecular formula C17H24N2O6S and a molecular weight of 384.45 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-hydroxy-2-[propan-2-yl(prop-2-ynoxymethoxy)sulfamoyl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-hydroxy-2-[propan-2-yl(prop-2-ynoxymethoxy)sulfamoyl]acetamide |
|---|---|
| PubChem CID | 150437938 |
| Molecular Formula | C17H24N2O6S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-hydroxy-2-[propan-2-yl(prop-2-ynoxymethoxy)sulfamoyl]acetamide |
| SMILES | C#CCOCON(C(C)C)S(=O)(=O)C(O)C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C17H24N2O6S/c1-6-10-24-11-25-19(12(2)3)26(22,23)17(21)16(20)18-15-13(4)8-7-9-14(15)5/h1,7-9,12,17,21H,10-11H2,2-5H3,(H,18,20) |
| InChIKey | HLDWGAPMCPLMRW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|