C14H20ClNO2 — CID 67892291
2-chloro-N-(2,6-dimethylphenyl)-3-propan-2-yloxypropanamide (PubChem CID 67892291) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is 2-chloro-N-(2,6-dimethylphenyl)-3-propan-2-yloxypropanamide.
| Compound Name | 2-chloro-N-(2,6-dimethylphenyl)-3-propan-2-yloxypropanamide |
|---|---|
| PubChem CID | 67892291 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-chloro-N-(2,6-dimethylphenyl)-3-propan-2-yloxypropanamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(Cl)COC(C)C |
| InChI | InChI=1S/C14H20ClNO2/c1-9(2)18-8-12(15)14(17)16-13-10(3)6-5-7-11(13)4/h5-7,9,12H,8H2,1-4H3,(H,16,17) |
| InChIKey | ABJDDXOZILOVSN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|