C17H27FN2O6S — CID 172822196
N-(2,6-dimethylphenyl)-2-[2-fluoropropyl(propan-2-yloxymethoxy)sulfamoyl]-2-hydroxyacetamide (PubChem CID 172822196) has the molecular formula C17H27FN2O6S and a molecular weight of 406.48 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[2-fluoropropyl(propan-2-yloxymethoxy)sulfamoyl]-2-hydroxyacetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[2-fluoropropyl(propan-2-yloxymethoxy)sulfamoyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 172822196 |
| Molecular Formula | C17H27FN2O6S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[2-fluoropropyl(propan-2-yloxymethoxy)sulfamoyl]-2-hydroxyacetamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(O)S(=O)(=O)N(CC(C)F)OCOC(C)C |
| InChI | InChI=1S/C17H27FN2O6S/c1-11(2)25-10-26-20(9-14(5)18)27(23,24)17(22)16(21)19-15-12(3)7-6-8-13(15)4/h6-8,11,14,17,22H,9-10H2,1-5H3,(H,19,21) |
| InChIKey | UJKVSADDPXREHP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|