C29H38N4O3 — CID 155807507
(E)-N-[[4-[[1-(3,4-dimethylphenyl)triazol-4-yl]methoxy]-3-methoxyphenyl]methyl]-8-methylnon-6-enamide (PubChem CID 155807507) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is (E)-N-[[4-[[1-(3,4-dimethylphenyl)triazol-4-yl]methoxy]-3-methoxyphenyl]methyl]-8-methylnon-6-enamide.
| Compound Name | (E)-N-[[4-[[1-(3,4-dimethylphenyl)triazol-4-yl]methoxy]-3-methoxyphenyl]methyl]-8-methylnon-6-enamide |
|---|---|
| PubChem CID | 155807507 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | (E)-N-[[4-[[1-(3,4-dimethylphenyl)triazol-4-yl]methoxy]-3-methoxyphenyl]methyl]-8-methylnon-6-enamide |
| SMILES | COc1cc(CNC(=O)CCCC/C=C/C(C)C)ccc1OCc1cn(-c2ccc(C)c(C)c2)nn1 |
| InChI | InChI=1S/C29H38N4O3/c1-21(2)10-8-6-7-9-11-29(34)30-18-24-13-15-27(28(17-24)35-5)36-20-25-19-33(32-31-25)26-14-12-22(3)23(4)16-26/h8,10,12-17,19,21H,6-7,9,11,18,20H2,1-5H3,(H,30,34)/b10-8+ |
| InChIKey | IOSLWAARRWMGKF-CSKARUKUSA-N |
| XLogP | 5.86 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|