C28H33N5O3 — CID 155816770
(E)-N-[[4-[[1-(4-cyanophenyl)triazol-4-yl]methoxy]-3-methoxyphenyl]methyl]-8-methylnon-6-enamide (PubChem CID 155816770) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is (E)-N-[[4-[[1-(4-cyanophenyl)triazol-4-yl]methoxy]-3-methoxyphenyl]methyl]-8-methylnon-6-enamide.
| Compound Name | (E)-N-[[4-[[1-(4-cyanophenyl)triazol-4-yl]methoxy]-3-methoxyphenyl]methyl]-8-methylnon-6-enamide |
|---|---|
| PubChem CID | 155816770 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | (E)-N-[[4-[[1-(4-cyanophenyl)triazol-4-yl]methoxy]-3-methoxyphenyl]methyl]-8-methylnon-6-enamide |
| SMILES | COc1cc(CNC(=O)CCCC/C=C/C(C)C)ccc1OCc1cn(-c2ccc(C#N)cc2)nn1 |
| InChI | InChI=1S/C28H33N5O3/c1-21(2)8-6-4-5-7-9-28(34)30-18-23-12-15-26(27(16-23)35-3)36-20-24-19-33(32-31-24)25-13-10-22(17-29)11-14-25/h6,8,10-16,19,21H,4-5,7,9,18,20H2,1-3H3,(H,30,34)/b8-6+ |
| InChIKey | UOFHRRCAQXCYDN-SOFGYWHQSA-N |
| XLogP | 5.12 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|