C15H15FN4O3S2 — CID 122245732
4-ethoxy-3-fluoro-N-[(1-thiophen-2-yltriazol-4-yl)methyl]benzenesulfonamide (PubChem CID 122245732) has the molecular formula C15H15FN4O3S2 and a molecular weight of 382.44 g/mol. Its IUPAC name is 4-ethoxy-3-fluoro-N-[(1-thiophen-2-yltriazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | 4-ethoxy-3-fluoro-N-[(1-thiophen-2-yltriazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122245732 |
| Molecular Formula | C15H15FN4O3S2 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 4-ethoxy-3-fluoro-N-[(1-thiophen-2-yltriazol-4-yl)methyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCc2cn(-c3cccs3)nn2)cc1F |
| InChI | InChI=1S/C15H15FN4O3S2/c1-2-23-14-6-5-12(8-13(14)16)25(21,22)17-9-11-10-20(19-18-11)15-4-3-7-24-15/h3-8,10,17H,2,9H2,1H3 |
| InChIKey | LSPBYTOFVXXQJW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |