C11H15NO2S — CID 126816815
N-[2-(hydroxymethyl)-3-thiophen-3-ylpropyl]prop-2-enamide (PubChem CID 126816815) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is N-[2-(hydroxymethyl)-3-thiophen-3-ylpropyl]prop-2-enamide.
| Compound Name | N-[2-(hydroxymethyl)-3-thiophen-3-ylpropyl]prop-2-enamide |
|---|---|
| PubChem CID | 126816815 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | N-[2-(hydroxymethyl)-3-thiophen-3-ylpropyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(CO)Cc1ccsc1 |
| InChI | InChI=1S/C11H15NO2S/c1-2-11(14)12-6-10(7-13)5-9-3-4-15-8-9/h2-4,8,10,13H,1,5-7H2,(H,12,14) |
| InChIKey | YGLRNSNZYJUCIE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|