C12H19NO2S — CID 66179515
N-(2-hydroxy-2,4-dimethylpentyl)thiophene-3-carboxamide (PubChem CID 66179515) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is N-(2-hydroxy-2,4-dimethylpentyl)thiophene-3-carboxamide.
| Compound Name | N-(2-hydroxy-2,4-dimethylpentyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 66179515 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-(2-hydroxy-2,4-dimethylpentyl)thiophene-3-carboxamide |
| SMILES | CC(C)CC(C)(O)CNC(=O)c1ccsc1 |
| InChI | InChI=1S/C12H19NO2S/c1-9(2)6-12(3,15)8-13-11(14)10-4-5-16-7-10/h4-5,7,9,15H,6,8H2,1-3H3,(H,13,14) |
| InChIKey | RNBCFTSLYZQCJE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |