C22H18N2O7 — CID 46791532
[2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)acetate (PubChem CID 46791532) has the molecular formula C22H18N2O7 and a molecular weight of 422.39 g/mol. Its IUPAC name is [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)acetate.
| Compound Name | [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 46791532 |
| Molecular Formula | C22H18N2O7 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)acetate |
| SMILES | COc1cc2c(cc1NC(=O)COC(=O)CNC(=O)c1ccco1)oc1ccccc12 |
| InChI | InChI=1S/C22H18N2O7/c1-28-19-9-14-13-5-2-3-6-16(13)31-18(14)10-15(19)24-20(25)12-30-21(26)11-23-22(27)17-7-4-8-29-17/h2-10H,11-12H2,1H3,(H,23,27)(H,24,25) |
| InChIKey | VMXPYMGNHNOMCM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |