C16H15BrN2O3 — CID 51220288
3-bromo-N-[2-oxo-2-(phenylmethoxyamino)ethyl]benzamide (PubChem CID 51220288) has the molecular formula C16H15BrN2O3 and a molecular weight of 363.21 g/mol. Its IUPAC name is 3-bromo-N-[2-oxo-2-(phenylmethoxyamino)ethyl]benzamide.
| Compound Name | 3-bromo-N-[2-oxo-2-(phenylmethoxyamino)ethyl]benzamide |
|---|---|
| PubChem CID | 51220288 |
| Molecular Formula | C16H15BrN2O3 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 3-bromo-N-[2-oxo-2-(phenylmethoxyamino)ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(Br)c1)NOCc1ccccc1 |
| InChI | InChI=1S/C16H15BrN2O3/c17-14-8-4-7-13(9-14)16(21)18-10-15(20)19-22-11-12-5-2-1-3-6-12/h1-9H,10-11H2,(H,18,21)(H,19,20) |
| InChIKey | QVPUBMUJMAKSEE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|