C23H24N2O2 — CID 55651913
3-(cyclohexanecarbonylamino)-N-(3-phenylprop-2-ynyl)benzamide (PubChem CID 55651913) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-(cyclohexanecarbonylamino)-N-(3-phenylprop-2-ynyl)benzamide.
| Compound Name | 3-(cyclohexanecarbonylamino)-N-(3-phenylprop-2-ynyl)benzamide |
|---|---|
| PubChem CID | 55651913 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 3-(cyclohexanecarbonylamino)-N-(3-phenylprop-2-ynyl)benzamide |
| SMILES | O=C(NCC#Cc1ccccc1)c1cccc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C23H24N2O2/c26-22(24-16-8-11-18-9-3-1-4-10-18)20-14-7-15-21(17-20)25-23(27)19-12-5-2-6-13-19/h1,3-4,7,9-10,14-15,17,19H,2,5-6,12-13,16H2,(H,24,26)(H,25,27) |
| InChIKey | DPJQOYQWZSCOSA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|