C21H19N3O7S — CID 55385384
[2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate (PubChem CID 55385384) has the molecular formula C21H19N3O7S and a molecular weight of 457.46 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate.
| Compound Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate |
|---|---|
| PubChem CID | 55385384 |
| Molecular Formula | C21H19N3O7S |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate |
| SMILES | CN1C(=O)c2ccc(NC(=O)COC(=O)c3ccc4c(c3)CCN4S(C)(=O)=O)cc2C1=O |
| InChI | InChI=1S/C21H19N3O7S/c1-23-19(26)15-5-4-14(10-16(15)20(23)27)22-18(25)11-31-21(28)13-3-6-17-12(9-13)7-8-24(17)32(2,29)30/h3-6,9-10H,7-8,11H2,1-2H3,(H,22,25) |
| InChIKey | XQRKRMWCNNIECM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|