C23H24N2O7S — CID 55936614
[2-(4-methylsulfonylanilino)-2-oxoethyl] (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate (PubChem CID 55936614) has the molecular formula C23H24N2O7S and a molecular weight of 472.52 g/mol. Its IUPAC name is [2-(4-methylsulfonylanilino)-2-oxoethyl] (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate.
| Compound Name | [2-(4-methylsulfonylanilino)-2-oxoethyl] (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate |
|---|---|
| PubChem CID | 55936614 |
| Molecular Formula | C23H24N2O7S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | [2-(4-methylsulfonylanilino)-2-oxoethyl] (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@@H](C(=O)OCC(=O)Nc1ccc(S(C)(=O)=O)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H24N2O7S/c1-4-14(2)20(25-21(27)17-7-5-6-8-18(17)22(25)28)23(29)32-13-19(26)24-15-9-11-16(12-10-15)33(3,30)31/h5-12,14,20H,4,13H2,1-3H3,(H,24,26)/t14-,20-/m0/s1 |
| InChIKey | MZQHGTGQCDBGQF-XOBRGWDASA-N |
| XLogP | 2.28 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|