C17H12Cl2N4O2 — CID 166216580
6-amino-5-chloro-N-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]pyridine-3-carboxamide (PubChem CID 166216580) has the molecular formula C17H12Cl2N4O2 and a molecular weight of 375.22 g/mol. Its IUPAC name is 6-amino-5-chloro-N-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]pyridine-3-carboxamide.
| Compound Name | 6-amino-5-chloro-N-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166216580 |
| Molecular Formula | C17H12Cl2N4O2 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 6-amino-5-chloro-N-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]pyridine-3-carboxamide |
| SMILES | Nc1ncc(C(=O)Nc2ccc(Oc3ccc(Cl)cn3)cc2)cc1Cl |
| InChI | InChI=1S/C17H12Cl2N4O2/c18-11-1-6-15(21-9-11)25-13-4-2-12(3-5-13)23-17(24)10-7-14(19)16(20)22-8-10/h1-9H,(H2,20,22)(H,23,24) |
| InChIKey | NAEBULDMWRBHCV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |