C20H16Cl2N4O3 — CID 86616532
N-[6-[4-(2-amino-2-hydroxyiminoethyl)phenoxy]-3-pyridinyl]-3,4-dichlorobenzamide (PubChem CID 86616532) has the molecular formula C20H16Cl2N4O3 and a molecular weight of 431.28 g/mol. Its IUPAC name is N-[6-[4-(2-amino-2-hydroxyiminoethyl)phenoxy]-3-pyridinyl]-3,4-dichlorobenzamide.
| Compound Name | N-[6-[4-(2-amino-2-hydroxyiminoethyl)phenoxy]-3-pyridinyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 86616532 |
| Molecular Formula | C20H16Cl2N4O3 |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | N-[6-[4-(2-amino-2-hydroxyiminoethyl)phenoxy]-3-pyridinyl]-3,4-dichlorobenzamide |
| SMILES | NC(Cc1ccc(Oc2ccc(NC(=O)c3ccc(Cl)c(Cl)c3)cn2)cc1)=NO |
| InChI | InChI=1S/C20H16Cl2N4O3/c21-16-7-3-13(10-17(16)22)20(27)25-14-4-8-19(24-11-14)29-15-5-1-12(2-6-15)9-18(23)26-28/h1-8,10-11,28H,9H2,(H2,23,26)(H,25,27) |
| InChIKey | YTYAWURUQVHPEQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|