C23H16Cl2N4O5S — CID 87483944
3,4-dichloro-N-[6-[4-[[2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetyl]amino]phenoxy]-3-pyridinyl]benzamide (PubChem CID 87483944) has the molecular formula C23H16Cl2N4O5S and a molecular weight of 531.38 g/mol. Its IUPAC name is 3,4-dichloro-N-[6-[4-[[2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetyl]amino]phenoxy]-3-pyridinyl]benzamide.
| Compound Name | 3,4-dichloro-N-[6-[4-[[2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetyl]amino]phenoxy]-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 87483944 |
| Molecular Formula | C23H16Cl2N4O5S |
| Molecular Weight | 531.38 g/mol |
| Exact Mass | 530.02 |
| IUPAC Name | 3,4-dichloro-N-[6-[4-[[2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetyl]amino]phenoxy]-3-pyridinyl]benzamide |
| SMILES | O=C(CC1SC(=O)NC1=O)Nc1ccc(Oc2ccc(NC(=O)c3ccc(Cl)c(Cl)c3)cn2)cc1 |
| InChI | InChI=1S/C23H16Cl2N4O5S/c24-16-7-1-12(9-17(16)25)21(31)28-14-4-8-20(26-11-14)34-15-5-2-13(3-6-15)27-19(30)10-18-22(32)29-23(33)35-18/h1-9,11,18H,10H2,(H,27,30)(H,28,31)(H,29,32,33) |
| InChIKey | MDYNNVSTEMCJCC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.38 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|