C25H24Cl2N2O4 — CID 68525138
ethyl 5-[4-[[5-[(3,4-dichlorobenzoyl)amino]-2-pyridinyl]oxy]phenyl]pentanoate (PubChem CID 68525138) has the molecular formula C25H24Cl2N2O4 and a molecular weight of 487.38 g/mol. Its IUPAC name is ethyl 5-[4-[[5-[(3,4-dichlorobenzoyl)amino]-2-pyridinyl]oxy]phenyl]pentanoate.
| Compound Name | ethyl 5-[4-[[5-[(3,4-dichlorobenzoyl)amino]-2-pyridinyl]oxy]phenyl]pentanoate |
|---|---|
| PubChem CID | 68525138 |
| Molecular Formula | C25H24Cl2N2O4 |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | ethyl 5-[4-[[5-[(3,4-dichlorobenzoyl)amino]-2-pyridinyl]oxy]phenyl]pentanoate |
| SMILES | CCOC(=O)CCCCc1ccc(Oc2ccc(NC(=O)c3ccc(Cl)c(Cl)c3)cn2)cc1 |
| InChI | InChI=1S/C25H24Cl2N2O4/c1-2-32-24(30)6-4-3-5-17-7-11-20(12-8-17)33-23-14-10-19(16-28-23)29-25(31)18-9-13-21(26)22(27)15-18/h7-16H,2-6H2,1H3,(H,29,31) |
| InChIKey | LFNDQUUJMHEWGO-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|