C27H26Cl2N2O2 — CID 143481862
3,4-dichloro-N-[6-[4-(3-ethenyl-1,3-dimethylcyclopentyl)phenoxy]-3-pyridinyl]benzamide (PubChem CID 143481862) has the molecular formula C27H26Cl2N2O2 and a molecular weight of 481.42 g/mol. Its IUPAC name is 3,4-dichloro-N-[6-[4-(3-ethenyl-1,3-dimethylcyclopentyl)phenoxy]-3-pyridinyl]benzamide.
| Compound Name | 3,4-dichloro-N-[6-[4-(3-ethenyl-1,3-dimethylcyclopentyl)phenoxy]-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 143481862 |
| Molecular Formula | C27H26Cl2N2O2 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 3,4-dichloro-N-[6-[4-(3-ethenyl-1,3-dimethylcyclopentyl)phenoxy]-3-pyridinyl]benzamide |
| SMILES | C=CC1(C)CCC(C)(c2ccc(Oc3ccc(NC(=O)c4ccc(Cl)c(Cl)c4)cn3)cc2)C1 |
| InChI | InChI=1S/C27H26Cl2N2O2/c1-4-26(2)13-14-27(3,17-26)19-6-9-21(10-7-19)33-24-12-8-20(16-30-24)31-25(32)18-5-11-22(28)23(29)15-18/h4-12,15-16H,1,13-14,17H2,2-3H3,(H,31,32) |
| InChIKey | SFVKJNSPGADTCZ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|