C19H12Cl2N4O4 — CID 3123654
3,4-dichloro-N-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]benzamide (PubChem CID 3123654) has the molecular formula C19H12Cl2N4O4 and a molecular weight of 431.24 g/mol. Its IUPAC name is 3,4-dichloro-N-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]benzamide.
| Compound Name | 3,4-dichloro-N-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 3123654 |
| Molecular Formula | C19H12Cl2N4O4 |
| Molecular Weight | 431.24 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 3,4-dichloro-N-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1ccc(Oc2ccc([N+](=O)[O-])cn2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H12Cl2N4O4/c20-16-7-3-13(9-17(16)21)19(26)24-23-10-12-1-5-15(6-2-12)29-18-8-4-14(11-22-18)25(27)28/h1-11H,(H,24,26) |
| InChIKey | GYPYISYCYSJZJO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.24 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|