C22H17Cl2N3O3 — CID 87952683
3,4-dichloro-N-[6-[[(1E)-1-methoxyimino-2,3-dihydroinden-4-yl]oxy]-3-pyridinyl]benzamide (PubChem CID 87952683) has the molecular formula C22H17Cl2N3O3 and a molecular weight of 442.30 g/mol. Its IUPAC name is 3,4-dichloro-N-[6-[[(1E)-1-methoxyimino-2,3-dihydroinden-4-yl]oxy]-3-pyridinyl]benzamide.
| Compound Name | 3,4-dichloro-N-[6-[[(1E)-1-methoxyimino-2,3-dihydroinden-4-yl]oxy]-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 87952683 |
| Molecular Formula | C22H17Cl2N3O3 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 3,4-dichloro-N-[6-[[(1E)-1-methoxyimino-2,3-dihydroinden-4-yl]oxy]-3-pyridinyl]benzamide |
| SMILES | CO/N=C1\CCc2c(Oc3ccc(NC(=O)c4ccc(Cl)c(Cl)c4)cn3)cccc21 |
| InChI | InChI=1S/C22H17Cl2N3O3/c1-29-27-19-9-7-16-15(19)3-2-4-20(16)30-21-10-6-14(12-25-21)26-22(28)13-5-8-17(23)18(24)11-13/h2-6,8,10-12H,7,9H2,1H3,(H,26,28)/b27-19+ |
| InChIKey | LTEKFACBMSIWHB-ZXVVBBHZSA-N |
| XLogP | 5.73 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|