C11H10ClNO3S — CID 90999176
methyl 3-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)propanoate (PubChem CID 90999176) has the molecular formula C11H10ClNO3S and a molecular weight of 271.73 g/mol. Its IUPAC name is methyl 3-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)propanoate.
| Compound Name | methyl 3-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)propanoate |
|---|---|
| PubChem CID | 90999176 |
| Molecular Formula | C11H10ClNO3S |
| Molecular Weight | 271.73 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | methyl 3-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)propanoate |
| SMILES | COC(=O)CCn1c(=O)sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C11H10ClNO3S/c1-16-10(14)4-5-13-8-6-7(12)2-3-9(8)17-11(13)15/h2-3,6H,4-5H2,1H3 |
| InChIKey | FCHVKTBEOWEOIZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.73 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |